C26H29N5O3S2 — CID 155567052
3-(2-methoxyethylamino)-N-[3-[5-(6-methoxy-3-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide (PubChem CID 155567052) has the molecular formula C26H29N5O3S2 and a molecular weight of 523.68 g/mol. Its IUPAC name is 3-(2-methoxyethylamino)-N-[3-[5-(6-methoxy-3-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide.
| Compound Name | 3-(2-methoxyethylamino)-N-[3-[5-(6-methoxy-3-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
|---|---|
| PubChem CID | 155567052 |
| Molecular Formula | C26H29N5O3S2 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | 3-(2-methoxyethylamino)-N-[3-[5-(6-methoxy-3-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
| SMILES | COCCNCCC(=O)Nc1sc2c(c1-c1nc3cc(-c4ccc(OC)nc4)ccc3s1)CCNC2 |
| InChI | InChI=1S/C26H29N5O3S2/c1-33-12-11-27-10-8-22(32)31-26-24(18-7-9-28-15-21(18)36-26)25-30-19-13-16(3-5-20(19)35-25)17-4-6-23(34-2)29-14-17/h3-6,13-14,27-28H,7-12,15H2,1-2H3,(H,31,32) |
| InChIKey | QRRIXNNXSKJVFJ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|