C21H27N3O3 — CID 155567115
N-[[(4aR,8aR)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyran-4a-yl]methyl]-3-(2-aminoquinolin-3-yl)propanamide (PubChem CID 155567115) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[[(4aR,8aR)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyran-4a-yl]methyl]-3-(2-aminoquinolin-3-yl)propanamide.
| Compound Name | N-[[(4aR,8aR)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyran-4a-yl]methyl]-3-(2-aminoquinolin-3-yl)propanamide |
|---|---|
| PubChem CID | 155567115 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | N-[[(4aR,8aR)-3,4,5,7,8,8a-hexahydro-2H-pyrano[3,2-c]pyran-4a-yl]methyl]-3-(2-aminoquinolin-3-yl)propanamide |
| SMILES | Nc1nc2ccccc2cc1CCC(=O)NC[C@@]12CCCO[C@@H]1CCOC2 |
| InChI | InChI=1S/C21H27N3O3/c22-20-16(12-15-4-1-2-5-17(15)24-20)6-7-19(25)23-13-21-9-3-10-27-18(21)8-11-26-14-21/h1-2,4-5,12,18H,3,6-11,13-14H2,(H2,22,24)(H,23,25)/t18-,21-/m1/s1 |
| InChIKey | QOQRRAFGOBMJCS-WIYYLYMNSA-N |
| XLogP | 2.45 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |