About 4-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]butanoic acid;hydrochloride
4-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]butanoic acid;hydrochloride (PubChem CID 155567131) has the molecular formula C23H27ClN4O4
and a molecular weight of 458.95 g/mol. Its IUPAC name is 4-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]butanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 4-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]butanoic acid;hydrochloride |
| PubChem CID | 155567131 |
| Molecular Formula | C23H27ClN4O4 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 4-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]butanoic acid;hydrochloride |
| SMILES | Cl.Nc1nc(N)c(-c2ccccc2)c(CCCOc2cccc(OCCCC(=O)O)c2)n1 |
| InChI | InChI=1S/C23H26N4O4.ClH/c24-22-21(16-7-2-1-3-8-16)19(26-23(25)27-22)11-5-13-30-17-9-4-10-18(15-17)31-14-6-12-20(28)29;/h1-4,7-10,15H,5-6,11-14H2,(H,28,29)(H4,24,25,26,27);1H |
| InChIKey | MGULVEZYIYOSEV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 133.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]butanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]butanoic acid;hydrochloride?
The IUPAC name of 4-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]butanoic acid;hydrochloride (CID 155567131) is 4-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]butanoic acid;hydrochloride.
What is the SMILES notation for 4-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]butanoic acid;hydrochloride?
The canonical SMILES for 4-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]butanoic acid;hydrochloride is Cl.Nc1nc(N)c(-c2ccccc2)c(CCCOc2cccc(OCCCC(=O)O)c2)n1.
What is the InChIKey of 4-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]butanoic acid;hydrochloride?
The InChIKey is MGULVEZYIYOSEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H26N4O4.ClH/c24-22-21(16-7-2-1-3-8-16)19(26-23(25)27-22)11-5-13-30-17-9-4-10-18(15-17)31-14-6-12-20(28)29;/h1-4,7-10,15H,5-6,11-14H2,(H,28,29)(H4,24,25,26,27);1H.
What are the key properties of 4-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]butanoic acid;hydrochloride?
4-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]butanoic acid;hydrochloride has a molecular weight of 458.95 g/mol, XLogP of 3.98, 11 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[3-(2,6-diamino-5-phenylpyrimidin-4-yl)propoxy]phenoxy]butanoic acid;hydrochloride is sourced from PubChem (CID 155567131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).