C25H37NO5 — CID 155567225
dimethyl (2S)-2-[[(1R,4aR,4bR,10aR)-1-methyl-7-propan-2-yl-3,4,4a,4b,5,6,10,10a-octahydro-2H-phenanthrene-1-carbonyl]amino]butanedioate (PubChem CID 155567225) has the molecular formula C25H37NO5 and a molecular weight of 431.57 g/mol. Its IUPAC name is dimethyl (2S)-2-[[(1R,4aR,4bR,10aR)-1-methyl-7-propan-2-yl-3,4,4a,4b,5,6,10,10a-octahydro-2H-phenanthrene-1-carbonyl]amino]butanedioate.
| Compound Name | dimethyl (2S)-2-[[(1R,4aR,4bR,10aR)-1-methyl-7-propan-2-yl-3,4,4a,4b,5,6,10,10a-octahydro-2H-phenanthrene-1-carbonyl]amino]butanedioate |
|---|---|
| PubChem CID | 155567225 |
| Molecular Formula | C25H37NO5 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | dimethyl (2S)-2-[[(1R,4aR,4bR,10aR)-1-methyl-7-propan-2-yl-3,4,4a,4b,5,6,10,10a-octahydro-2H-phenanthrene-1-carbonyl]amino]butanedioate |
| SMILES | COC(=O)C[C@H](NC(=O)[C@]1(C)CCC[C@H]2[C@H]1CC=C1C=C(C(C)C)CC[C@@H]12)C(=O)OC |
| InChI | InChI=1S/C25H37NO5/c1-15(2)16-8-10-18-17(13-16)9-11-20-19(18)7-6-12-25(20,3)24(29)26-21(23(28)31-5)14-22(27)30-4/h9,13,15,18-21H,6-8,10-12,14H2,1-5H3,(H,26,29)/t18-,19+,20+,21-,25+/m0/s1 |
| InChIKey | YYJJWHRTVAEILB-AIBHGQCCSA-N |
| XLogP | 3.95 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |