About [5,5-bis(4-fluorophenyl)-4-(4-methylsulfonylphenyl)pent-4-enyl] nitrate
[5,5-bis(4-fluorophenyl)-4-(4-methylsulfonylphenyl)pent-4-enyl] nitrate (PubChem CID 155567231) has the molecular formula C24H21F2NO5S
and a molecular weight of 473.50 g/mol. Its IUPAC name is [5,5-bis(4-fluorophenyl)-4-(4-methylsulfonylphenyl)pent-4-enyl] nitrate.
Molecular Properties
| Compound Name | [5,5-bis(4-fluorophenyl)-4-(4-methylsulfonylphenyl)pent-4-enyl] nitrate |
| PubChem CID | 155567231 |
| Molecular Formula | C24H21F2NO5S |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | [5,5-bis(4-fluorophenyl)-4-(4-methylsulfonylphenyl)pent-4-enyl] nitrate |
| SMILES | CS(=O)(=O)c1ccc(C(CCCO[N+](=O)[O-])=C(c2ccc(F)cc2)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C24H21F2NO5S/c1-33(30,31)22-14-8-17(9-15-22)23(3-2-16-32-27(28)29)24(18-4-10-20(25)11-5-18)19-6-12-21(26)13-7-19/h4-15H,2-3,16H2,1H3 |
| InChIKey | CLWWKZXLZBJHDP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze [5,5-bis(4-fluorophenyl)-4-(4-methylsulfonylphenyl)pent-4-enyl] nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,5-bis(4-fluorophenyl)-4-(4-methylsulfonylphenyl)pent-4-enyl] nitrate?
The IUPAC name of [5,5-bis(4-fluorophenyl)-4-(4-methylsulfonylphenyl)pent-4-enyl] nitrate (CID 155567231) is [5,5-bis(4-fluorophenyl)-4-(4-methylsulfonylphenyl)pent-4-enyl] nitrate.
What is the SMILES notation for [5,5-bis(4-fluorophenyl)-4-(4-methylsulfonylphenyl)pent-4-enyl] nitrate?
The canonical SMILES for [5,5-bis(4-fluorophenyl)-4-(4-methylsulfonylphenyl)pent-4-enyl] nitrate is CS(=O)(=O)c1ccc(C(CCCO[N+](=O)[O-])=C(c2ccc(F)cc2)c2ccc(F)cc2)cc1.
What is the InChIKey of [5,5-bis(4-fluorophenyl)-4-(4-methylsulfonylphenyl)pent-4-enyl] nitrate?
The InChIKey is CLWWKZXLZBJHDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21F2NO5S/c1-33(30,31)22-14-8-17(9-15-22)23(3-2-16-32-27(28)29)24(18-4-10-20(25)11-5-18)19-6-12-21(26)13-7-19/h4-15H,2-3,16H2,1H3.
What are the key properties of [5,5-bis(4-fluorophenyl)-4-(4-methylsulfonylphenyl)pent-4-enyl] nitrate?
[5,5-bis(4-fluorophenyl)-4-(4-methylsulfonylphenyl)pent-4-enyl] nitrate has a molecular weight of 473.50 g/mol, XLogP of 5.32, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5,5-bis(4-fluorophenyl)-4-(4-methylsulfonylphenyl)pent-4-enyl] nitrate is sourced from PubChem (CID 155567231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).