C21H25FN2S2 — CID 155567544
1-[(4-fluorophenyl)methyl]-3-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)thiourea (PubChem CID 155567544) has the molecular formula C21H25FN2S2 and a molecular weight of 388.58 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)thiourea |
|---|---|
| PubChem CID | 155567544 |
| Molecular Formula | C21H25FN2S2 |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-(2,2,4,4-tetramethyl-3H-thiochromen-6-yl)thiourea |
| SMILES | CC1(C)CC(C)(C)c2cc(NC(=S)NCc3ccc(F)cc3)ccc2S1 |
| InChI | InChI=1S/C21H25FN2S2/c1-20(2)13-21(3,4)26-18-10-9-16(11-17(18)20)24-19(25)23-12-14-5-7-15(22)8-6-14/h5-11H,12-13H2,1-4H3,(H2,23,24,25) |
| InChIKey | BUOAZNUEMZJWIW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|