C24H29F2N7O — CID 155567732
5-N-(3,5-difluorophenyl)-5-N-ethyl-3-N-[(1R,5S)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-1-methyl-1,2,4-triazole-3,5-diamine (PubChem CID 155567732) has the molecular formula C24H29F2N7O and a molecular weight of 469.54 g/mol. Its IUPAC name is 5-N-(3,5-difluorophenyl)-5-N-ethyl-3-N-[(1R,5S)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-1-methyl-1,2,4-triazole-3,5-diamine.
| Compound Name | 5-N-(3,5-difluorophenyl)-5-N-ethyl-3-N-[(1R,5S)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-1-methyl-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 155567732 |
| Molecular Formula | C24H29F2N7O |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.24 |
| IUPAC Name | 5-N-(3,5-difluorophenyl)-5-N-ethyl-3-N-[(1R,5S)-3-(2-methoxy-4-pyridinyl)-3-azabicyclo[3.2.1]octan-8-yl]-1-methyl-1,2,4-triazole-3,5-diamine |
| SMILES | CCN(c1cc(F)cc(F)c1)c1nc(NC2[C@@H]3CC[C@H]2CN(c2ccnc(OC)c2)C3)nn1C |
| InChI | InChI=1S/C24H29F2N7O/c1-4-33(20-10-17(25)9-18(26)11-20)24-29-23(30-31(24)2)28-22-15-5-6-16(22)14-32(13-15)19-7-8-27-21(12-19)34-3/h7-12,15-16,22H,4-6,13-14H2,1-3H3,(H,28,30)/t15-,16+,22? |
| InChIKey | RHENVMNEVGZWAP-XVQYUUQNSA-N |
| XLogP | 3.98 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |