C20H26O4 — CID 155567841
(3aS,4R,10E,11aR)-4-[(E)-4-hydroxy-2-methylbut-2-enoyl]-6,10-dimethyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one (PubChem CID 155567841) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is (3aS,4R,10E,11aR)-4-[(E)-4-hydroxy-2-methylbut-2-enoyl]-6,10-dimethyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one.
| Compound Name | (3aS,4R,10E,11aR)-4-[(E)-4-hydroxy-2-methylbut-2-enoyl]-6,10-dimethyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one |
|---|---|
| PubChem CID | 155567841 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | (3aS,4R,10E,11aR)-4-[(E)-4-hydroxy-2-methylbut-2-enoyl]-6,10-dimethyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)CCC=C(C)C[C@@H](C(=O)/C(C)=C/CO)[C@@H]12 |
| InChI | InChI=1S/C20H26O4/c1-12-6-5-7-13(2)11-17-18(15(4)20(23)24-17)16(10-12)19(22)14(3)8-9-21/h6,8,11,16-18,21H,4-5,7,9-10H2,1-3H3/b12-6?,13-11+,14-8+/t16-,17-,18-/m1/s1 |
| InChIKey | CVKHUORGQRAYFR-JYMWGPGASA-N |
| XLogP | 3.28 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|