About 2-[3-[3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propoxy]phenoxy]acetic acid;hydrochloride
2-[3-[3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propoxy]phenoxy]acetic acid;hydrochloride (PubChem CID 155567948) has the molecular formula C21H22Cl2N4O4
and a molecular weight of 465.34 g/mol. Its IUPAC name is 2-[3-[3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propoxy]phenoxy]acetic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-[3-[3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propoxy]phenoxy]acetic acid;hydrochloride |
| PubChem CID | 155567948 |
| Molecular Formula | C21H22Cl2N4O4 |
| Molecular Weight | 465.34 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 2-[3-[3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propoxy]phenoxy]acetic acid;hydrochloride |
| SMILES | Cl.Nc1nc(N)c(-c2cccc(Cl)c2)c(CCCOc2cccc(OCC(=O)O)c2)n1 |
| InChI | InChI=1S/C21H21ClN4O4.ClH/c22-14-5-1-4-13(10-14)19-17(25-21(24)26-20(19)23)8-3-9-29-15-6-2-7-16(11-15)30-12-18(27)28;/h1-2,4-7,10-11H,3,8-9,12H2,(H,27,28)(H4,23,24,25,26);1H |
| InChIKey | IWYQOJYSTVYVOO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 133.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 465.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-[3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propoxy]phenoxy]acetic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propoxy]phenoxy]acetic acid;hydrochloride?
The IUPAC name of 2-[3-[3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propoxy]phenoxy]acetic acid;hydrochloride (CID 155567948) is 2-[3-[3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propoxy]phenoxy]acetic acid;hydrochloride.
What is the SMILES notation for 2-[3-[3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propoxy]phenoxy]acetic acid;hydrochloride?
The canonical SMILES for 2-[3-[3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propoxy]phenoxy]acetic acid;hydrochloride is Cl.Nc1nc(N)c(-c2cccc(Cl)c2)c(CCCOc2cccc(OCC(=O)O)c2)n1.
What is the InChIKey of 2-[3-[3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propoxy]phenoxy]acetic acid;hydrochloride?
The InChIKey is IWYQOJYSTVYVOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21ClN4O4.ClH/c22-14-5-1-4-13(10-14)19-17(25-21(24)26-20(19)23)8-3-9-29-15-6-2-7-16(11-15)30-12-18(27)28;/h1-2,4-7,10-11H,3,8-9,12H2,(H,27,28)(H4,23,24,25,26);1H.
What are the key properties of 2-[3-[3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propoxy]phenoxy]acetic acid;hydrochloride?
2-[3-[3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propoxy]phenoxy]acetic acid;hydrochloride has a molecular weight of 465.34 g/mol, XLogP of 3.86, 9 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[3-[2,6-diamino-5-(3-chlorophenyl)pyrimidin-4-yl]propoxy]phenoxy]acetic acid;hydrochloride is sourced from PubChem (CID 155567948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).