C40H50Cl2N2O5S — CID 155568092
6-[2-[(E)-2-[(3E)-2-chloro-3-[(2E)-2-[3,3-dimethyl-1-(4-sulfobutyl)indol-2-ylidene]ethylidene]cyclohexen-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]hexanoic acid chloride (PubChem CID 155568092) has the molecular formula C40H50Cl2N2O5S and a molecular weight of 741.82 g/mol. Its IUPAC name is 6-[2-[(E)-2-[(3E)-2-chloro-3-[(2E)-2-[3,3-dimethyl-1-(4-sulfobutyl)indol-2-ylidene]ethylidene]cyclohexen-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]hexanoic acid chloride.
| Compound Name | 6-[2-[(E)-2-[(3E)-2-chloro-3-[(2E)-2-[3,3-dimethyl-1-(4-sulfobutyl)indol-2-ylidene]ethylidene]cyclohexen-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]hexanoic acid chloride |
|---|---|
| PubChem CID | 155568092 |
| Molecular Formula | C40H50Cl2N2O5S |
| Molecular Weight | 741.82 g/mol |
| Exact Mass | 740.28 |
| IUPAC Name | 6-[2-[(E)-2-[(3E)-2-chloro-3-[(2E)-2-[3,3-dimethyl-1-(4-sulfobutyl)indol-2-ylidene]ethylidene]cyclohexen-1-yl]ethenyl]-3,3-dimethylindol-1-ium-1-yl]hexanoic acid chloride |
| SMILES | CC1(C)C(/C=C/C2=C(Cl)/C(=C/C=C3/N(CCCCS(=O)(=O)O)c4ccccc4C3(C)C)CCC2)=[N+](CCCCCC(=O)O)c2ccccc21.[Cl-] |
| InChI | InChI=1S/C40H49ClN2O5S.ClH/c1-39(2)31-17-7-9-19-33(31)42(26-11-5-6-21-37(44)45)35(39)24-22-29-15-14-16-30(38(29)41)23-25-36-40(3,4)32-18-8-10-20-34(32)43(36)27-12-13-28-49(46,47)48;/h7-10,17-20,22-25H,5-6,11-16,21,26-28H2,1-4H3,(H-,44,45,46,47,48);1H |
| InChIKey | LQZRJJJESUPLAR-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.82 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|