C17H10BrN3O2S — CID 155568099
(5E)-5-[[4-(4-bromopyrrolo[2,3-b]pyridin-1-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 155568099) has the molecular formula C17H10BrN3O2S and a molecular weight of 400.26 g/mol. Its IUPAC name is (5E)-5-[[4-(4-bromopyrrolo[2,3-b]pyridin-1-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[4-(4-bromopyrrolo[2,3-b]pyridin-1-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 155568099 |
| Molecular Formula | C17H10BrN3O2S |
| Molecular Weight | 400.26 g/mol |
| Exact Mass | 398.97 |
| IUPAC Name | (5E)-5-[[4-(4-bromopyrrolo[2,3-b]pyridin-1-yl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C\c2ccc(-n3ccc4c(Br)ccnc43)cc2)S1 |
| InChI | InChI=1S/C17H10BrN3O2S/c18-13-5-7-19-15-12(13)6-8-21(15)11-3-1-10(2-4-11)9-14-16(22)20-17(23)24-14/h1-9H,(H,20,22,23)/b14-9+ |
| InChIKey | YAZFVSUANGBNBJ-NTEUORMPSA-N |
| XLogP | 4.11 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.26 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|