C23H23F3N6O2 — CID 155568314
2,2,2-trifluoro-N-[3-[[[6-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]methyl]phenyl]acetamide (PubChem CID 155568314) has the molecular formula C23H23F3N6O2 and a molecular weight of 472.47 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[3-[[[6-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]methyl]phenyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[3-[[[6-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 155568314 |
| Molecular Formula | C23H23F3N6O2 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 2,2,2-trifluoro-N-[3-[[[6-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]methyl]phenyl]acetamide |
| SMILES | O=C(Nc1cccc(CNc2cc(Nc3ccc(N4CCOCC4)cc3)ncn2)c1)C(F)(F)F |
| InChI | InChI=1S/C23H23F3N6O2/c24-23(25,26)22(33)31-18-3-1-2-16(12-18)14-27-20-13-21(29-15-28-20)30-17-4-6-19(7-5-17)32-8-10-34-11-9-32/h1-7,12-13,15H,8-11,14H2,(H,31,33)(H2,27,28,29,30) |
| InChIKey | YAYOHXUMNOSODP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|