C16H23N5S — CID 155568415
1-[3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]piperazine (PubChem CID 155568415) has the molecular formula C16H23N5S and a molecular weight of 317.46 g/mol. Its IUPAC name is 1-[3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]piperazine.
| Compound Name | 1-[3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]piperazine |
|---|---|
| PubChem CID | 155568415 |
| Molecular Formula | C16H23N5S |
| Molecular Weight | 317.46 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1-[3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]piperazine |
| SMILES | Cn1c(SCCCN2CCNCC2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C16H23N5S/c1-20-15(14-6-3-2-4-7-14)18-19-16(20)22-13-5-10-21-11-8-17-9-12-21/h2-4,6-7,17H,5,8-13H2,1H3 |
| InChIKey | XJKRLEJMJPXVGM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|