About 2-[3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]anilino]benzamide
2-[3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]anilino]benzamide (PubChem CID 155568441) has the molecular formula C21H21N5O2S
and a molecular weight of 407.50 g/mol. Its IUPAC name is 2-[3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]anilino]benzamide.
Molecular Properties
| Compound Name | 2-[3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]anilino]benzamide |
| PubChem CID | 155568441 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 2-[3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]anilino]benzamide |
| SMILES | Cc1cc(C)nc(SCC(=O)Nc2cccc(Nc3ccccc3C(N)=O)c2)n1 |
| InChI | InChI=1S/C21H21N5O2S/c1-13-10-14(2)24-21(23-13)29-12-19(27)26-16-7-5-6-15(11-16)25-18-9-4-3-8-17(18)20(22)28/h3-11,25H,12H2,1-2H3,(H2,22,28)(H,26,27) |
| InChIKey | TWTPPOVCBVJGKQ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]anilino]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]anilino]benzamide?
The IUPAC name of 2-[3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]anilino]benzamide (CID 155568441) is 2-[3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]anilino]benzamide.
What is the SMILES notation for 2-[3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]anilino]benzamide?
The canonical SMILES for 2-[3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]anilino]benzamide is Cc1cc(C)nc(SCC(=O)Nc2cccc(Nc3ccccc3C(N)=O)c2)n1.
What is the InChIKey of 2-[3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]anilino]benzamide?
The InChIKey is TWTPPOVCBVJGKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N5O2S/c1-13-10-14(2)24-21(23-13)29-12-19(27)26-16-7-5-6-15(11-16)25-18-9-4-3-8-17(18)20(22)28/h3-11,25H,12H2,1-2H3,(H2,22,28)(H,26,27).
What are the key properties of 2-[3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]anilino]benzamide?
2-[3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]anilino]benzamide has a molecular weight of 407.50 g/mol, XLogP of 3.67, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[[2-(4,6-dimethylpyrimidin-2-yl)sulfanylacetyl]amino]anilino]benzamide is sourced from PubChem (CID 155568441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).