About 1-(5-anilino-3,4-dihydro-1H-isoquinolin-2-yl)-3-(methylamino)propan-2-ol
1-(5-anilino-3,4-dihydro-1H-isoquinolin-2-yl)-3-(methylamino)propan-2-ol (PubChem CID 155568483) has the molecular formula C19H25N3O
and a molecular weight of 311.43 g/mol. Its IUPAC name is 1-(5-anilino-3,4-dihydro-1H-isoquinolin-2-yl)-3-(methylamino)propan-2-ol.
Molecular Properties
| Compound Name | 1-(5-anilino-3,4-dihydro-1H-isoquinolin-2-yl)-3-(methylamino)propan-2-ol |
| PubChem CID | 155568483 |
| Molecular Formula | C19H25N3O |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | 1-(5-anilino-3,4-dihydro-1H-isoquinolin-2-yl)-3-(methylamino)propan-2-ol |
| SMILES | CNCC(O)CN1CCc2c(cccc2Nc2ccccc2)C1 |
| InChI | InChI=1S/C19H25N3O/c1-20-12-17(23)14-22-11-10-18-15(13-22)6-5-9-19(18)21-16-7-3-2-4-8-16/h2-9,17,20-21,23H,10-14H2,1H3 |
| InChIKey | ILMSCLZXPITTOT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-anilino-3,4-dihydro-1H-isoquinolin-2-yl)-3-(methylamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-anilino-3,4-dihydro-1H-isoquinolin-2-yl)-3-(methylamino)propan-2-ol?
The IUPAC name of 1-(5-anilino-3,4-dihydro-1H-isoquinolin-2-yl)-3-(methylamino)propan-2-ol (CID 155568483) is 1-(5-anilino-3,4-dihydro-1H-isoquinolin-2-yl)-3-(methylamino)propan-2-ol.
What is the SMILES notation for 1-(5-anilino-3,4-dihydro-1H-isoquinolin-2-yl)-3-(methylamino)propan-2-ol?
The canonical SMILES for 1-(5-anilino-3,4-dihydro-1H-isoquinolin-2-yl)-3-(methylamino)propan-2-ol is CNCC(O)CN1CCc2c(cccc2Nc2ccccc2)C1.
What is the InChIKey of 1-(5-anilino-3,4-dihydro-1H-isoquinolin-2-yl)-3-(methylamino)propan-2-ol?
The InChIKey is ILMSCLZXPITTOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H25N3O/c1-20-12-17(23)14-22-11-10-18-15(13-22)6-5-9-19(18)21-16-7-3-2-4-8-16/h2-9,17,20-21,23H,10-14H2,1H3.
What are the key properties of 1-(5-anilino-3,4-dihydro-1H-isoquinolin-2-yl)-3-(methylamino)propan-2-ol?
1-(5-anilino-3,4-dihydro-1H-isoquinolin-2-yl)-3-(methylamino)propan-2-ol has a molecular weight of 311.43 g/mol, XLogP of 2.37, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-anilino-3,4-dihydro-1H-isoquinolin-2-yl)-3-(methylamino)propan-2-ol is sourced from PubChem (CID 155568483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).