C17H22N2O11P2 — CID 155568906
[[(2R,3S,4R,5R)-5-(3-benzyl-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 155568906) has the molecular formula C17H22N2O11P2 and a molecular weight of 492.31 g/mol. Its IUPAC name is [[(2R,3S,4R,5R)-5-(3-benzyl-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [[(2R,3S,4R,5R)-5-(3-benzyl-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 155568906 |
| Molecular Formula | C17H22N2O11P2 |
| Molecular Weight | 492.31 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | [[(2R,3S,4R,5R)-5-(3-benzyl-2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)(O)CP(=O)(O)O)[C@@H](O)[C@H]2O)c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C17H22N2O11P2/c20-13-6-7-18(17(23)19(13)8-11-4-2-1-3-5-11)16-15(22)14(21)12(30-16)9-29-32(27,28)10-31(24,25)26/h1-7,12,14-16,21-22H,8-10H2,(H,27,28)(H2,24,25,26)/t12-,14-,15-,16-/m1/s1 |
| InChIKey | QETXFSRFIKPTQR-DTZQCDIJSA-N |
| XLogP | -0.99 |
| TPSA | 197.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.31 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|