C25H29F6N5O2 — CID 155569033
N-cyclopropyl-3-[4-[(R)-(2,4-difluorophenyl)-fluoromethyl]piperidin-1-yl]-6-methyl-7,8-dihydro-5H-pyrido[3,4-b]pyrazin-2-amine;2,2,2-trifluoroacetic acid (PubChem CID 155569033) has the molecular formula C25H29F6N5O2 and a molecular weight of 545.53 g/mol. Its IUPAC name is N-cyclopropyl-3-[4-[(R)-(2,4-difluorophenyl)-fluoromethyl]piperidin-1-yl]-6-methyl-7,8-dihydro-5H-pyrido[3,4-b]pyrazin-2-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-cyclopropyl-3-[4-[(R)-(2,4-difluorophenyl)-fluoromethyl]piperidin-1-yl]-6-methyl-7,8-dihydro-5H-pyrido[3,4-b]pyrazin-2-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155569033 |
| Molecular Formula | C25H29F6N5O2 |
| Molecular Weight | 545.53 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | N-cyclopropyl-3-[4-[(R)-(2,4-difluorophenyl)-fluoromethyl]piperidin-1-yl]-6-methyl-7,8-dihydro-5H-pyrido[3,4-b]pyrazin-2-amine;2,2,2-trifluoroacetic acid |
| SMILES | CN1CCc2nc(NC3CC3)c(N3CCC([C@@H](F)c4ccc(F)cc4F)CC3)nc2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H28F3N5.C2HF3O2/c1-30-9-8-19-20(13-30)29-23(22(28-19)27-16-3-4-16)31-10-6-14(7-11-31)21(26)17-5-2-15(24)12-18(17)25;3-2(4,5)1(6)7/h2,5,12,14,16,21H,3-4,6-11,13H2,1H3,(H,27,28);(H,6,7)/t21-;/m1./s1 |
| InChIKey | ZJCBDHUMJJHXSF-ZMBIFBSDSA-N |
| XLogP | 4.88 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.53 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |