About 10-[5-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]pentyl]phenoxazine
10-[5-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]pentyl]phenoxazine (PubChem CID 155569036) has the molecular formula C36H48N2O2
and a molecular weight of 540.79 g/mol. Its IUPAC name is 10-[5-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]pentyl]phenoxazine.
Molecular Properties
| Compound Name | 10-[5-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]pentyl]phenoxazine |
| PubChem CID | 155569036 |
| Molecular Formula | C36H48N2O2 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.37 |
| IUPAC Name | 10-[5-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]pentyl]phenoxazine |
| SMILES | CCCCCCCCc1ccc([C@H]2CCN[C@@H]2COCCCCCN2c3ccccc3Oc3ccccc32)cc1 |
| InChI | InChI=1S/C36H48N2O2/c1-2-3-4-5-6-8-15-29-20-22-30(23-21-29)31-24-25-37-32(31)28-39-27-14-7-13-26-38-33-16-9-11-18-35(33)40-36-19-12-10-17-34(36)38/h9-12,16-23,31-32,37H,2-8,13-15,24-28H2,1H3/t31-,32-/m1/s1 |
| InChIKey | ADLROULHXBTFLN-ROJLCIKYSA-N |
| XLogP | 9.17 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_666_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-[5-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]pentyl]phenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[5-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]pentyl]phenoxazine?
The IUPAC name of 10-[5-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]pentyl]phenoxazine (CID 155569036) is 10-[5-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]pentyl]phenoxazine.
What is the SMILES notation for 10-[5-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]pentyl]phenoxazine?
The canonical SMILES for 10-[5-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]pentyl]phenoxazine is CCCCCCCCc1ccc([C@H]2CCN[C@@H]2COCCCCCN2c3ccccc3Oc3ccccc32)cc1.
What is the InChIKey of 10-[5-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]pentyl]phenoxazine?
The InChIKey is ADLROULHXBTFLN-ROJLCIKYSA-N. The full InChI is InChI=1S/C36H48N2O2/c1-2-3-4-5-6-8-15-29-20-22-30(23-21-29)31-24-25-37-32(31)28-39-27-14-7-13-26-38-33-16-9-11-18-35(33)40-36-19-12-10-17-34(36)38/h9-12,16-23,31-32,37H,2-8,13-15,24-28H2,1H3/t31-,32-/m1/s1.
What are the key properties of 10-[5-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]pentyl]phenoxazine?
10-[5-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]pentyl]phenoxazine has a molecular weight of 540.79 g/mol, XLogP of 9.17, 16 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[5-[[(2S,3R)-3-(4-octylphenyl)pyrrolidin-2-yl]methoxy]pentyl]phenoxazine is sourced from PubChem (CID 155569036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).