C30H38O6 — CID 155569189
[(1R,3E,5R,7S,10E,12S,13S,14S)-1-acetyloxy-10-(hydroxymethyl)-3,6,6,14-tetramethyl-2-oxo-13-tricyclo[10.3.0.05,7]pentadeca-3,10-dienyl] 2-phenylacetate (PubChem CID 155569189) has the molecular formula C30H38O6 and a molecular weight of 494.63 g/mol. Its IUPAC name is [(1R,3E,5R,7S,10E,12S,13S,14S)-1-acetyloxy-10-(hydroxymethyl)-3,6,6,14-tetramethyl-2-oxo-13-tricyclo[10.3.0.05,7]pentadeca-3,10-dienyl] 2-phenylacetate.
| Compound Name | [(1R,3E,5R,7S,10E,12S,13S,14S)-1-acetyloxy-10-(hydroxymethyl)-3,6,6,14-tetramethyl-2-oxo-13-tricyclo[10.3.0.05,7]pentadeca-3,10-dienyl] 2-phenylacetate |
|---|---|
| PubChem CID | 155569189 |
| Molecular Formula | C30H38O6 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | [(1R,3E,5R,7S,10E,12S,13S,14S)-1-acetyloxy-10-(hydroxymethyl)-3,6,6,14-tetramethyl-2-oxo-13-tricyclo[10.3.0.05,7]pentadeca-3,10-dienyl] 2-phenylacetate |
| SMILES | CC(=O)O[C@]12C[C@H](C)[C@H](OC(=O)Cc3ccccc3)[C@@H]1/C=C(/CO)CC[C@H]1[C@@H](/C=C(\C)C2=O)C1(C)C |
| InChI | InChI=1S/C30H38O6/c1-18-13-24-23(29(24,4)5)12-11-22(17-31)14-25-27(35-26(33)15-21-9-7-6-8-10-21)19(2)16-30(25,28(18)34)36-20(3)32/h6-10,13-14,19,23-25,27,31H,11-12,15-17H2,1-5H3/b18-13+,22-14+/t19-,23-,24+,25-,27-,30+/m0/s1 |
| InChIKey | VBNBFKLESBQURY-BEJADBNPSA-N |
| XLogP | 4.60 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|