C26H22N4O3S2 — CID 155569203
ethyl 2-[(E)-[(5Z)-5-[(1-benzylindol-3-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 155569203) has the molecular formula C26H22N4O3S2 and a molecular weight of 502.62 g/mol. Its IUPAC name is ethyl 2-[(E)-[(5Z)-5-[(1-benzylindol-3-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(E)-[(5Z)-5-[(1-benzylindol-3-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 155569203 |
| Molecular Formula | C26H22N4O3S2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | ethyl 2-[(E)-[(5Z)-5-[(1-benzylindol-3-yl)methylidene]-4-oxo-1,3-thiazolidin-2-ylidene]amino]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(/N=C2\NC(=O)/C(=C/c3cn(Cc4ccccc4)c4ccccc34)S2)nc1C |
| InChI | InChI=1S/C26H22N4O3S2/c1-3-33-24(32)22-16(2)27-25(35-22)29-26-28-23(31)21(34-26)13-18-15-30(14-17-9-5-4-6-10-17)20-12-8-7-11-19(18)20/h4-13,15H,3,14H2,1-2H3,(H,27,28,29,31)/b21-13- |
| InChIKey | ILLSDPMMZNHVIL-BKUYFWCQSA-N |
| XLogP | 5.52 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|