C33H42N2O2 — CID 155569276
(3E,5E,7E,9Z,11Z,13S,17E,19E,21E,23E,25Z,27Z,29S)-3,13,17,19,29-pentamethyl-1,15-diazacyclotriaconta-3,5,7,9,11,17,19,21,23,25,27-undecaene-2,16-dione (PubChem CID 155569276) has the molecular formula C33H42N2O2 and a molecular weight of 498.71 g/mol. Its IUPAC name is (3E,5E,7E,9Z,11Z,13S,17E,19E,21E,23E,25Z,27Z,29S)-3,13,17,19,29-pentamethyl-1,15-diazacyclotriaconta-3,5,7,9,11,17,19,21,23,25,27-undecaene-2,16-dione.
| Compound Name | (3E,5E,7E,9Z,11Z,13S,17E,19E,21E,23E,25Z,27Z,29S)-3,13,17,19,29-pentamethyl-1,15-diazacyclotriaconta-3,5,7,9,11,17,19,21,23,25,27-undecaene-2,16-dione |
|---|---|
| PubChem CID | 155569276 |
| Molecular Formula | C33H42N2O2 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | (3E,5E,7E,9Z,11Z,13S,17E,19E,21E,23E,25Z,27Z,29S)-3,13,17,19,29-pentamethyl-1,15-diazacyclotriaconta-3,5,7,9,11,17,19,21,23,25,27-undecaene-2,16-dione |
| SMILES | CC1=C\C=C\C=C\C=C/C=C\[C@H](C)CNC(=O)/C(C)=C/C=C/C=C/C=C/C=C\[C@H](C)CNC(=O)\C(C)=C\1 |
| InChI | InChI=1S/C33H42N2O2/c1-27-20-16-12-8-6-9-13-17-21-28(2)25-34-32(36)30(4)23-19-15-11-7-10-14-18-22-29(3)26-35-33(37)31(5)24-27/h6-24,28-29H,25-26H2,1-5H3,(H,34,36)(H,35,37)/b8-6+,11-7+,13-9-,14-10+,16-12+,19-15+,21-17-,22-18-,27-20+,30-23+,31-24+/t28-,29-/m0/s1 |
| InChIKey | PKDOHWFBCZCSLM-ZMWUNYKXSA-N |
| XLogP | 6.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |