About 3-[(5-morpholin-4-yl-1,3-benzoxazol-2-yl)sulfanyl]-1-pyrrolidin-1-ylpropan-1-one
3-[(5-morpholin-4-yl-1,3-benzoxazol-2-yl)sulfanyl]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 155569282) has the molecular formula C18H23N3O3S
and a molecular weight of 361.47 g/mol. Its IUPAC name is 3-[(5-morpholin-4-yl-1,3-benzoxazol-2-yl)sulfanyl]-1-pyrrolidin-1-ylpropan-1-one.
Molecular Properties
| Compound Name | 3-[(5-morpholin-4-yl-1,3-benzoxazol-2-yl)sulfanyl]-1-pyrrolidin-1-ylpropan-1-one |
| PubChem CID | 155569282 |
| Molecular Formula | C18H23N3O3S |
| Molecular Weight | 361.47 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 3-[(5-morpholin-4-yl-1,3-benzoxazol-2-yl)sulfanyl]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | O=C(CCSc1nc2cc(N3CCOCC3)ccc2o1)N1CCCC1 |
| InChI | InChI=1S/C18H23N3O3S/c22-17(21-6-1-2-7-21)5-12-25-18-19-15-13-14(3-4-16(15)24-18)20-8-10-23-11-9-20/h3-4,13H,1-2,5-12H2 |
| InChIKey | CXFUJCLJDDFZMD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.47 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(5-morpholin-4-yl-1,3-benzoxazol-2-yl)sulfanyl]-1-pyrrolidin-1-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-morpholin-4-yl-1,3-benzoxazol-2-yl)sulfanyl]-1-pyrrolidin-1-ylpropan-1-one?
The IUPAC name of 3-[(5-morpholin-4-yl-1,3-benzoxazol-2-yl)sulfanyl]-1-pyrrolidin-1-ylpropan-1-one (CID 155569282) is 3-[(5-morpholin-4-yl-1,3-benzoxazol-2-yl)sulfanyl]-1-pyrrolidin-1-ylpropan-1-one.
What is the SMILES notation for 3-[(5-morpholin-4-yl-1,3-benzoxazol-2-yl)sulfanyl]-1-pyrrolidin-1-ylpropan-1-one?
The canonical SMILES for 3-[(5-morpholin-4-yl-1,3-benzoxazol-2-yl)sulfanyl]-1-pyrrolidin-1-ylpropan-1-one is O=C(CCSc1nc2cc(N3CCOCC3)ccc2o1)N1CCCC1.
What is the InChIKey of 3-[(5-morpholin-4-yl-1,3-benzoxazol-2-yl)sulfanyl]-1-pyrrolidin-1-ylpropan-1-one?
The InChIKey is CXFUJCLJDDFZMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N3O3S/c22-17(21-6-1-2-7-21)5-12-25-18-19-15-13-14(3-4-16(15)24-18)20-8-10-23-11-9-20/h3-4,13H,1-2,5-12H2.
What are the key properties of 3-[(5-morpholin-4-yl-1,3-benzoxazol-2-yl)sulfanyl]-1-pyrrolidin-1-ylpropan-1-one?
3-[(5-morpholin-4-yl-1,3-benzoxazol-2-yl)sulfanyl]-1-pyrrolidin-1-ylpropan-1-one has a molecular weight of 361.47 g/mol, XLogP of 2.77, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-morpholin-4-yl-1,3-benzoxazol-2-yl)sulfanyl]-1-pyrrolidin-1-ylpropan-1-one is sourced from PubChem (CID 155569282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).