C29H37N5O2 — CID 155569291
(3S)-3-[3-(5-methylpyrazol-1-yl)phenyl]-4-[(3R)-1-methyl-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-ium-1-yl]butanoate (PubChem CID 155569291) has the molecular formula C29H37N5O2 and a molecular weight of 487.65 g/mol. Its IUPAC name is (3S)-3-[3-(5-methylpyrazol-1-yl)phenyl]-4-[(3R)-1-methyl-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-ium-1-yl]butanoate.
| Compound Name | (3S)-3-[3-(5-methylpyrazol-1-yl)phenyl]-4-[(3R)-1-methyl-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-ium-1-yl]butanoate |
|---|---|
| PubChem CID | 155569291 |
| Molecular Formula | C29H37N5O2 |
| Molecular Weight | 487.65 g/mol |
| Exact Mass | 487.29 |
| IUPAC Name | (3S)-3-[3-(5-methylpyrazol-1-yl)phenyl]-4-[(3R)-1-methyl-3-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrrolidin-1-ium-1-yl]butanoate |
| SMILES | Cc1ccnn1-c1cccc([C@H](CC(=O)[O-])C[N+]2(C)CC[C@@H](CCc3ccc4c(n3)NCCC4)C2)c1 |
| InChI | InChI=1S/C29H37N5O2/c1-21-12-15-31-33(21)27-7-3-5-24(17-27)25(18-28(35)36)20-34(2)16-13-22(19-34)8-10-26-11-9-23-6-4-14-30-29(23)32-26/h3,5,7,9,11-12,15,17,22,25H,4,6,8,10,13-14,16,18-20H2,1-2H3,(H-,30,32,35,36)/t22-,25-,34?/m1/s1 |
| InChIKey | FNDMWTXEBTVCPM-YNGTVUGESA-N |
| XLogP | 3.26 |
| TPSA | 82.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.65 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|