C39H38Cl2FN5O5 — CID 155569311
CID 155569311 (PubChem CID 155569311) has the molecular formula C39H38Cl2FN5O5 and a molecular weight of 746.67 g/mol.
| Compound Name | CID 155569311 |
|---|---|
| PubChem CID | 155569311 |
| Molecular Formula | C39H38Cl2FN5O5 |
| Molecular Weight | 746.67 g/mol |
| Exact Mass | 745.22 |
| IUPAC Name | — |
| SMILES | O=C1CCC(N2Cc3c(CCCNC(=O)[C@@H]4NC5(CCCCC5)[C@@]5(C(=O)Nc6cc(Cl)ccc65)[C@H]4c4cccc(Cl)c4F)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C39H38Cl2FN5O5/c40-22-12-13-26-28(19-22)44-37(52)39(26)31(24-10-5-11-27(41)32(24)42)33(46-38(39)16-2-1-3-17-38)35(50)43-18-6-8-21-7-4-9-23-25(21)20-47(36(23)51)29-14-15-30(48)45-34(29)49/h4-5,7,9-13,19,29,31,33,46H,1-3,6,8,14-18,20H2,(H,43,50)(H,44,52)(H,45,48,49)/t29?,31-,33+,39+/m0/s1 |
| InChIKey | KNKHUJFFUZTHJK-RQZSDGGCSA-N |
| XLogP | 5.29 |
| TPSA | 136.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|