About (4Z)-4-ethylidene-1-methoxy-5,6-dihydro-1H-pyrano[3,4-c]pyran-8-one
(4Z)-4-ethylidene-1-methoxy-5,6-dihydro-1H-pyrano[3,4-c]pyran-8-one (PubChem CID 155569338) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is (4Z)-4-ethylidene-1-methoxy-5,6-dihydro-1H-pyrano[3,4-c]pyran-8-one.
Molecular Properties
| Compound Name | (4Z)-4-ethylidene-1-methoxy-5,6-dihydro-1H-pyrano[3,4-c]pyran-8-one |
| PubChem CID | 155569338 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (4Z)-4-ethylidene-1-methoxy-5,6-dihydro-1H-pyrano[3,4-c]pyran-8-one |
| SMILES | C/C=C1\COC(OC)C2=C1CCOC2=O |
| InChI | InChI=1S/C11H14O4/c1-3-7-6-15-11(13-2)9-8(7)4-5-14-10(9)12/h3,11H,4-6H2,1-2H3/b7-3+ |
| InChIKey | WJWUZBXBSOJHOD-XVNBXDOJSA-N |
| XLogP | 1.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4Z)-4-ethylidene-1-methoxy-5,6-dihydro-1H-pyrano[3,4-c]pyran-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-ethylidene-1-methoxy-5,6-dihydro-1H-pyrano[3,4-c]pyran-8-one?
The IUPAC name of (4Z)-4-ethylidene-1-methoxy-5,6-dihydro-1H-pyrano[3,4-c]pyran-8-one (CID 155569338) is (4Z)-4-ethylidene-1-methoxy-5,6-dihydro-1H-pyrano[3,4-c]pyran-8-one.
What is the SMILES notation for (4Z)-4-ethylidene-1-methoxy-5,6-dihydro-1H-pyrano[3,4-c]pyran-8-one?
The canonical SMILES for (4Z)-4-ethylidene-1-methoxy-5,6-dihydro-1H-pyrano[3,4-c]pyran-8-one is C/C=C1\COC(OC)C2=C1CCOC2=O.
What is the InChIKey of (4Z)-4-ethylidene-1-methoxy-5,6-dihydro-1H-pyrano[3,4-c]pyran-8-one?
The InChIKey is WJWUZBXBSOJHOD-XVNBXDOJSA-N. The full InChI is InChI=1S/C11H14O4/c1-3-7-6-15-11(13-2)9-8(7)4-5-14-10(9)12/h3,11H,4-6H2,1-2H3/b7-3+.
What are the key properties of (4Z)-4-ethylidene-1-methoxy-5,6-dihydro-1H-pyrano[3,4-c]pyran-8-one?
(4Z)-4-ethylidene-1-methoxy-5,6-dihydro-1H-pyrano[3,4-c]pyran-8-one has a molecular weight of 210.23 g/mol, XLogP of 1.18, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-ethylidene-1-methoxy-5,6-dihydro-1H-pyrano[3,4-c]pyran-8-one is sourced from PubChem (CID 155569338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).