C33H38N2O — CID 155569364
1-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-3-phenylmethoxy-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole (PubChem CID 155569364) has the molecular formula C33H38N2O and a molecular weight of 478.68 g/mol. Its IUPAC name is 1-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-3-phenylmethoxy-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole.
| Compound Name | 1-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-3-phenylmethoxy-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole |
|---|---|
| PubChem CID | 155569364 |
| Molecular Formula | C33H38N2O |
| Molecular Weight | 478.68 g/mol |
| Exact Mass | 478.30 |
| IUPAC Name | 1-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-3-phenylmethoxy-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl]benzimidazole |
| SMILES | C[C@]12CC[C@H](OCc3ccccc3)CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(n3cnc4ccccc43)=CC[C@@H]12 |
| InChI | InChI=1S/C33H38N2O/c1-32-18-16-25(36-21-23-8-4-3-5-9-23)20-24(32)12-13-26-27-14-15-31(33(27,2)19-17-28(26)32)35-22-34-29-10-6-7-11-30(29)35/h3-12,15,22,25-28H,13-14,16-21H2,1-2H3/t25-,26-,27-,28-,32-,33-/m0/s1 |
| InChIKey | NXQFSRYKPZJBHF-VJPGGQIVSA-N |
| XLogP | 8.04 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.68 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|