About 3-[3-(3-fluorophenyl)-1H-pyrazolo[4,3-c]pyridin-4-yl]phenol
3-[3-(3-fluorophenyl)-1H-pyrazolo[4,3-c]pyridin-4-yl]phenol (PubChem CID 155569518) has the molecular formula C18H12FN3O
and a molecular weight of 305.31 g/mol. Its IUPAC name is 3-[3-(3-fluorophenyl)-1H-pyrazolo[4,3-c]pyridin-4-yl]phenol.
Molecular Properties
| Compound Name | 3-[3-(3-fluorophenyl)-1H-pyrazolo[4,3-c]pyridin-4-yl]phenol |
| PubChem CID | 155569518 |
| Molecular Formula | C18H12FN3O |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 3-[3-(3-fluorophenyl)-1H-pyrazolo[4,3-c]pyridin-4-yl]phenol |
| SMILES | Oc1cccc(-c2nccc3[nH]nc(-c4cccc(F)c4)c23)c1 |
| InChI | InChI=1S/C18H12FN3O/c19-13-5-1-3-11(9-13)18-16-15(21-22-18)7-8-20-17(16)12-4-2-6-14(23)10-12/h1-10,23H,(H,21,22) |
| InChIKey | JXKSFBCWSKJZSF-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-(3-fluorophenyl)-1H-pyrazolo[4,3-c]pyridin-4-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(3-fluorophenyl)-1H-pyrazolo[4,3-c]pyridin-4-yl]phenol?
The IUPAC name of 3-[3-(3-fluorophenyl)-1H-pyrazolo[4,3-c]pyridin-4-yl]phenol (CID 155569518) is 3-[3-(3-fluorophenyl)-1H-pyrazolo[4,3-c]pyridin-4-yl]phenol.
What is the SMILES notation for 3-[3-(3-fluorophenyl)-1H-pyrazolo[4,3-c]pyridin-4-yl]phenol?
The canonical SMILES for 3-[3-(3-fluorophenyl)-1H-pyrazolo[4,3-c]pyridin-4-yl]phenol is Oc1cccc(-c2nccc3[nH]nc(-c4cccc(F)c4)c23)c1.
What is the InChIKey of 3-[3-(3-fluorophenyl)-1H-pyrazolo[4,3-c]pyridin-4-yl]phenol?
The InChIKey is JXKSFBCWSKJZSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12FN3O/c19-13-5-1-3-11(9-13)18-16-15(21-22-18)7-8-20-17(16)12-4-2-6-14(23)10-12/h1-10,23H,(H,21,22).
What are the key properties of 3-[3-(3-fluorophenyl)-1H-pyrazolo[4,3-c]pyridin-4-yl]phenol?
3-[3-(3-fluorophenyl)-1H-pyrazolo[4,3-c]pyridin-4-yl]phenol has a molecular weight of 305.31 g/mol, XLogP of 4.14, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(3-fluorophenyl)-1H-pyrazolo[4,3-c]pyridin-4-yl]phenol is sourced from PubChem (CID 155569518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).