C29H47N7O — CID 155569552
(2S)-2-amino-5-(diaminomethylideneamino)-N-[[1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-3-yl]methyl]pentanamide (PubChem CID 155569552) has the molecular formula C29H47N7O and a molecular weight of 509.74 g/mol. Its IUPAC name is (2S)-2-amino-5-(diaminomethylideneamino)-N-[[1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-3-yl]methyl]pentanamide.
| Compound Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-[[1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-3-yl]methyl]pentanamide |
|---|---|
| PubChem CID | 155569552 |
| Molecular Formula | C29H47N7O |
| Molecular Weight | 509.74 g/mol |
| Exact Mass | 509.38 |
| IUPAC Name | (2S)-2-amino-5-(diaminomethylideneamino)-N-[[1-[1-(4-propan-2-ylcyclohexyl)piperidin-4-yl]indol-3-yl]methyl]pentanamide |
| SMILES | CC(C)C1CCC(N2CCC(n3cc(CNC(=O)[C@@H](N)CCCN=C(N)N)c4ccccc43)CC2)CC1 |
| InChI | InChI=1S/C29H47N7O/c1-20(2)21-9-11-23(12-10-21)35-16-13-24(14-17-35)36-19-22(25-6-3-4-8-27(25)36)18-34-28(37)26(30)7-5-15-33-29(31)32/h3-4,6,8,19-21,23-24,26H,5,7,9-18,30H2,1-2H3,(H,34,37)(H4,31,32,33)/t21?,23?,26-/m0/s1 |
| InChIKey | WLQVWCBBPYAMOQ-KXUMESBHSA-N |
| XLogP | 3.49 |
| TPSA | 127.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.74 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|