About 6-(2,3-dimethylphenyl)-3-(6-methoxy-3-pyridinyl)imidazo[1,2-a]pyrazine
6-(2,3-dimethylphenyl)-3-(6-methoxy-3-pyridinyl)imidazo[1,2-a]pyrazine (PubChem CID 155569574) has the molecular formula C20H18N4O
and a molecular weight of 330.39 g/mol. Its IUPAC name is 6-(2,3-dimethylphenyl)-3-(6-methoxy-3-pyridinyl)imidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 6-(2,3-dimethylphenyl)-3-(6-methoxy-3-pyridinyl)imidazo[1,2-a]pyrazine |
| PubChem CID | 155569574 |
| Molecular Formula | C20H18N4O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 6-(2,3-dimethylphenyl)-3-(6-methoxy-3-pyridinyl)imidazo[1,2-a]pyrazine |
| SMILES | COc1ccc(-c2cnc3cnc(-c4cccc(C)c4C)cn23)cn1 |
| InChI | InChI=1S/C20H18N4O/c1-13-5-4-6-16(14(13)2)17-12-24-18(10-22-19(24)11-21-17)15-7-8-20(25-3)23-9-15/h4-12H,1-3H3 |
| InChIKey | SZSOJKKOKWIKNQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(2,3-dimethylphenyl)-3-(6-methoxy-3-pyridinyl)imidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,3-dimethylphenyl)-3-(6-methoxy-3-pyridinyl)imidazo[1,2-a]pyrazine?
The IUPAC name of 6-(2,3-dimethylphenyl)-3-(6-methoxy-3-pyridinyl)imidazo[1,2-a]pyrazine (CID 155569574) is 6-(2,3-dimethylphenyl)-3-(6-methoxy-3-pyridinyl)imidazo[1,2-a]pyrazine.
What is the SMILES notation for 6-(2,3-dimethylphenyl)-3-(6-methoxy-3-pyridinyl)imidazo[1,2-a]pyrazine?
The canonical SMILES for 6-(2,3-dimethylphenyl)-3-(6-methoxy-3-pyridinyl)imidazo[1,2-a]pyrazine is COc1ccc(-c2cnc3cnc(-c4cccc(C)c4C)cn23)cn1.
What is the InChIKey of 6-(2,3-dimethylphenyl)-3-(6-methoxy-3-pyridinyl)imidazo[1,2-a]pyrazine?
The InChIKey is SZSOJKKOKWIKNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18N4O/c1-13-5-4-6-16(14(13)2)17-12-24-18(10-22-19(24)11-21-17)15-7-8-20(25-3)23-9-15/h4-12H,1-3H3.
What are the key properties of 6-(2,3-dimethylphenyl)-3-(6-methoxy-3-pyridinyl)imidazo[1,2-a]pyrazine?
6-(2,3-dimethylphenyl)-3-(6-methoxy-3-pyridinyl)imidazo[1,2-a]pyrazine has a molecular weight of 330.39 g/mol, XLogP of 4.08, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,3-dimethylphenyl)-3-(6-methoxy-3-pyridinyl)imidazo[1,2-a]pyrazine is sourced from PubChem (CID 155569574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).