C29H30O8 — CID 155569589
3-[[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy]-2,2-dimethyl-3H-benzo[g][1]benzofuran-4,5-dione (PubChem CID 155569589) has the molecular formula C29H30O8 and a molecular weight of 506.55 g/mol. Its IUPAC name is 3-[[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy]-2,2-dimethyl-3H-benzo[g][1]benzofuran-4,5-dione.
| Compound Name | 3-[[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy]-2,2-dimethyl-3H-benzo[g][1]benzofuran-4,5-dione |
|---|---|
| PubChem CID | 155569589 |
| Molecular Formula | C29H30O8 |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 3-[[(3aR,5R,6R,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]methoxy]-2,2-dimethyl-3H-benzo[g][1]benzofuran-4,5-dione |
| SMILES | CC1(C)O[C@H]2O[C@H](COC3C4=C(OC3(C)C)c3ccccc3C(=O)C4=O)[C@@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C29H30O8/c1-28(2)26(20-22(31)21(30)17-12-8-9-13-18(17)23(20)35-28)33-15-19-24(32-14-16-10-6-5-7-11-16)25-27(34-19)37-29(3,4)36-25/h5-13,19,24-27H,14-15H2,1-4H3/t19-,24-,25-,26?,27-/m1/s1 |
| InChIKey | LIRLLGKTZVCTNS-XTNHUWDISA-N |
| XLogP | 3.82 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|