About 4-N,4-N-dibutyl-1-hydroxy-2-iminopyrimidine-4,6-diamine
4-N,4-N-dibutyl-1-hydroxy-2-iminopyrimidine-4,6-diamine (PubChem CID 15556993) has the molecular formula C12H23N5O
and a molecular weight of 253.35 g/mol. Its IUPAC name is 4-N,4-N-dibutyl-1-hydroxy-2-iminopyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 4-N,4-N-dibutyl-1-hydroxy-2-iminopyrimidine-4,6-diamine |
| PubChem CID | 15556993 |
| Molecular Formula | C12H23N5O |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 4-N,4-N-dibutyl-1-hydroxy-2-iminopyrimidine-4,6-diamine |
| SMILES | [H]/N=c1\nc(N(CCCC)CCCC)cc(N)n1O |
| InChI | InChI=1S/C12H23N5O/c1-3-5-7-16(8-6-4-2)11-9-10(13)17(18)12(14)15-11/h9,14,18H,3-8,13H2,1-2H3/b14-12+ |
| InChIKey | XRHMJBULRVQONL-WYMLVPIESA-N |
| XLogP | 1.59 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-N,4-N-dibutyl-1-hydroxy-2-iminopyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,4-N-dibutyl-1-hydroxy-2-iminopyrimidine-4,6-diamine?
The IUPAC name of 4-N,4-N-dibutyl-1-hydroxy-2-iminopyrimidine-4,6-diamine (CID 15556993) is 4-N,4-N-dibutyl-1-hydroxy-2-iminopyrimidine-4,6-diamine.
What is the SMILES notation for 4-N,4-N-dibutyl-1-hydroxy-2-iminopyrimidine-4,6-diamine?
The canonical SMILES for 4-N,4-N-dibutyl-1-hydroxy-2-iminopyrimidine-4,6-diamine is [H]/N=c1\nc(N(CCCC)CCCC)cc(N)n1O.
What is the InChIKey of 4-N,4-N-dibutyl-1-hydroxy-2-iminopyrimidine-4,6-diamine?
The InChIKey is XRHMJBULRVQONL-WYMLVPIESA-N. The full InChI is InChI=1S/C12H23N5O/c1-3-5-7-16(8-6-4-2)11-9-10(13)17(18)12(14)15-11/h9,14,18H,3-8,13H2,1-2H3/b14-12+.
What are the key properties of 4-N,4-N-dibutyl-1-hydroxy-2-iminopyrimidine-4,6-diamine?
4-N,4-N-dibutyl-1-hydroxy-2-iminopyrimidine-4,6-diamine has a molecular weight of 253.35 g/mol, XLogP of 1.59, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,4-N-dibutyl-1-hydroxy-2-iminopyrimidine-4,6-diamine is sourced from PubChem (CID 15556993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).