C19H14Cl2N2O4 — CID 155569985
2-[(3E)-2-(2-chlorophenyl)-3-[(4-chlorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]acetamide (PubChem CID 155569985) has the molecular formula C19H14Cl2N2O4 and a molecular weight of 405.24 g/mol. Its IUPAC name is 2-[(3E)-2-(2-chlorophenyl)-3-[(4-chlorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]acetamide.
| Compound Name | 2-[(3E)-2-(2-chlorophenyl)-3-[(4-chlorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 155569985 |
| Molecular Formula | C19H14Cl2N2O4 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 404.03 |
| IUPAC Name | 2-[(3E)-2-(2-chlorophenyl)-3-[(4-chlorophenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]acetamide |
| SMILES | NC(=O)CN1C(=O)C(=O)/C(=C(/O)c2ccc(Cl)cc2)C1c1ccccc1Cl |
| InChI | InChI=1S/C19H14Cl2N2O4/c20-11-7-5-10(6-8-11)17(25)15-16(12-3-1-2-4-13(12)21)23(9-14(22)24)19(27)18(15)26/h1-8,16,25H,9H2,(H2,22,24)/b17-15+ |
| InChIKey | YRCVWDLEYXQLFE-BMRADRMJSA-N |
| XLogP | 2.90 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|