C24H27N7 — CID 155570100
4-(1-but-3-enylpyrazol-4-yl)-N-(4-piperidin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 155570100) has the molecular formula C24H27N7 and a molecular weight of 413.53 g/mol. Its IUPAC name is 4-(1-but-3-enylpyrazol-4-yl)-N-(4-piperidin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-(1-but-3-enylpyrazol-4-yl)-N-(4-piperidin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 155570100 |
| Molecular Formula | C24H27N7 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 4-(1-but-3-enylpyrazol-4-yl)-N-(4-piperidin-4-ylphenyl)-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | C=CCCn1cc(-c2nc(Nc3ccc(C4CCNCC4)cc3)nc3[nH]ccc23)cn1 |
| InChI | InChI=1S/C24H27N7/c1-2-3-14-31-16-19(15-27-31)22-21-10-13-26-23(21)30-24(29-22)28-20-6-4-17(5-7-20)18-8-11-25-12-9-18/h2,4-7,10,13,15-16,18,25H,1,3,8-9,11-12,14H2,(H2,26,28,29,30) |
| InChIKey | OZUDWDBQZJPKOG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|