C24H40O2 — CID 155570311
2-(3-hydroxycyclohexyl)-5-(2,4,4,6,6-pentamethylheptan-2-yl)phenol (PubChem CID 155570311) has the molecular formula C24H40O2 and a molecular weight of 360.58 g/mol. Its IUPAC name is 2-(3-hydroxycyclohexyl)-5-(2,4,4,6,6-pentamethylheptan-2-yl)phenol.
| Compound Name | 2-(3-hydroxycyclohexyl)-5-(2,4,4,6,6-pentamethylheptan-2-yl)phenol |
|---|---|
| PubChem CID | 155570311 |
| Molecular Formula | C24H40O2 |
| Molecular Weight | 360.58 g/mol |
| Exact Mass | 360.30 |
| IUPAC Name | 2-(3-hydroxycyclohexyl)-5-(2,4,4,6,6-pentamethylheptan-2-yl)phenol |
| SMILES | CC(C)(C)CC(C)(C)CC(C)(C)c1ccc(C2CCCC(O)C2)c(O)c1 |
| InChI | InChI=1S/C24H40O2/c1-22(2,3)15-23(4,5)16-24(6,7)18-11-12-20(21(26)14-18)17-9-8-10-19(25)13-17/h11-12,14,17,19,25-26H,8-10,13,15-16H2,1-7H3 |
| InChIKey | PXOSNWXTIJIXIF-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.58 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |