C24H22F3N3O3S — CID 155571058
3-ethynyl-5-[(2S)-2-methoxy-1-(2-methyloxetan-3-yl)oxy-3-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]propyl]sulfanylpyridine (PubChem CID 155571058) has the molecular formula C24H22F3N3O3S and a molecular weight of 489.52 g/mol. Its IUPAC name is 3-ethynyl-5-[(2S)-2-methoxy-1-(2-methyloxetan-3-yl)oxy-3-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]propyl]sulfanylpyridine.
| Compound Name | 3-ethynyl-5-[(2S)-2-methoxy-1-(2-methyloxetan-3-yl)oxy-3-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]propyl]sulfanylpyridine |
|---|---|
| PubChem CID | 155571058 |
| Molecular Formula | C24H22F3N3O3S |
| Molecular Weight | 489.52 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 3-ethynyl-5-[(2S)-2-methoxy-1-(2-methyloxetan-3-yl)oxy-3-[4-(3,4,5-trifluorophenyl)pyrazol-1-yl]propyl]sulfanylpyridine |
| SMILES | C#Cc1cncc(SC(OC2COC2C)[C@H](Cn2cc(-c3cc(F)c(F)c(F)c3)cn2)OC)c1 |
| InChI | InChI=1S/C24H22F3N3O3S/c1-4-15-5-18(10-28-8-15)34-24(33-22-13-32-14(22)2)21(31-3)12-30-11-17(9-29-30)16-6-19(25)23(27)20(26)7-16/h1,5-11,14,21-22,24H,12-13H2,2-3H3/t14?,21-,22?,24?/m0/s1 |
| InChIKey | UTWVTEZSFFMMFN-KGWZJEINSA-N |
| XLogP | 4.28 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|