C20H20Cl2N4O3S2 — CID 155571065
4-chloro-2-[(2S)-3-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]-1-(2-ethoxyethoxy)-2-hydroxypropyl]sulfanylbenzonitrile (PubChem CID 155571065) has the molecular formula C20H20Cl2N4O3S2 and a molecular weight of 499.45 g/mol. Its IUPAC name is 4-chloro-2-[(2S)-3-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]-1-(2-ethoxyethoxy)-2-hydroxypropyl]sulfanylbenzonitrile.
| Compound Name | 4-chloro-2-[(2S)-3-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]-1-(2-ethoxyethoxy)-2-hydroxypropyl]sulfanylbenzonitrile |
|---|---|
| PubChem CID | 155571065 |
| Molecular Formula | C20H20Cl2N4O3S2 |
| Molecular Weight | 499.45 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | 4-chloro-2-[(2S)-3-[4-(4-chloro-1,3-thiazol-2-yl)pyrazol-1-yl]-1-(2-ethoxyethoxy)-2-hydroxypropyl]sulfanylbenzonitrile |
| SMILES | CCOCCOC(Sc1cc(Cl)ccc1C#N)[C@@H](O)Cn1cc(-c2nc(Cl)cs2)cn1 |
| InChI | InChI=1S/C20H20Cl2N4O3S2/c1-2-28-5-6-29-20(31-17-7-15(21)4-3-13(17)8-23)16(27)11-26-10-14(9-24-26)19-25-18(22)12-30-19/h3-4,7,9-10,12,16,20,27H,2,5-6,11H2,1H3/t16-,20?/m0/s1 |
| InChIKey | DPYYUSKYHTUXLK-DJZRFWRSSA-N |
| XLogP | 4.72 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.45 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|