About oxiran-2-ylmethyl prop-2-enedithioate
oxiran-2-ylmethyl prop-2-enedithioate (PubChem CID 155571323) has the molecular formula C6H8OS2
and a molecular weight of 160.26 g/mol. Its IUPAC name is oxiran-2-ylmethyl prop-2-enedithioate.
Molecular Properties
| Compound Name | oxiran-2-ylmethyl prop-2-enedithioate |
| PubChem CID | 155571323 |
| Molecular Formula | C6H8OS2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.00 |
| IUPAC Name | oxiran-2-ylmethyl prop-2-enedithioate |
| SMILES | C=CC(=S)SCC1CO1 |
| InChI | InChI=1S/C6H8OS2/c1-2-6(8)9-4-5-3-7-5/h2,5H,1,3-4H2 |
| InChIKey | WJPUCWJNFHMYDJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxiran-2-ylmethyl prop-2-enedithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxiran-2-ylmethyl prop-2-enedithioate?
The IUPAC name of oxiran-2-ylmethyl prop-2-enedithioate (CID 155571323) is oxiran-2-ylmethyl prop-2-enedithioate.
What is the SMILES notation for oxiran-2-ylmethyl prop-2-enedithioate?
The canonical SMILES for oxiran-2-ylmethyl prop-2-enedithioate is C=CC(=S)SCC1CO1.
What is the InChIKey of oxiran-2-ylmethyl prop-2-enedithioate?
The InChIKey is WJPUCWJNFHMYDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8OS2/c1-2-6(8)9-4-5-3-7-5/h2,5H,1,3-4H2.
What are the key properties of oxiran-2-ylmethyl prop-2-enedithioate?
oxiran-2-ylmethyl prop-2-enedithioate has a molecular weight of 160.26 g/mol, XLogP of 1.63, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxiran-2-ylmethyl prop-2-enedithioate is sourced from PubChem (CID 155571323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).