About 2-chloro-4-methoxy-5,6-dimethylpyrimidine;ethane
2-chloro-4-methoxy-5,6-dimethylpyrimidine;ethane (PubChem CID 155571429) has the molecular formula C9H15ClN2O
and a molecular weight of 202.68 g/mol. Its IUPAC name is 2-chloro-4-methoxy-5,6-dimethylpyrimidine;ethane.
Molecular Properties
| Compound Name | 2-chloro-4-methoxy-5,6-dimethylpyrimidine;ethane |
| PubChem CID | 155571429 |
| Molecular Formula | C9H15ClN2O |
| Molecular Weight | 202.68 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 2-chloro-4-methoxy-5,6-dimethylpyrimidine;ethane |
| SMILES | CC.COc1nc(Cl)nc(C)c1C |
| InChI | InChI=1S/C7H9ClN2O.C2H6/c1-4-5(2)9-7(8)10-6(4)11-3;1-2/h1-3H3;1-2H3 |
| InChIKey | PIJLYQHAEUAJEX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.68 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-4-methoxy-5,6-dimethylpyrimidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-methoxy-5,6-dimethylpyrimidine;ethane?
The IUPAC name of 2-chloro-4-methoxy-5,6-dimethylpyrimidine;ethane (CID 155571429) is 2-chloro-4-methoxy-5,6-dimethylpyrimidine;ethane.
What is the SMILES notation for 2-chloro-4-methoxy-5,6-dimethylpyrimidine;ethane?
The canonical SMILES for 2-chloro-4-methoxy-5,6-dimethylpyrimidine;ethane is CC.COc1nc(Cl)nc(C)c1C.
What is the InChIKey of 2-chloro-4-methoxy-5,6-dimethylpyrimidine;ethane?
The InChIKey is PIJLYQHAEUAJEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O.C2H6/c1-4-5(2)9-7(8)10-6(4)11-3;1-2/h1-3H3;1-2H3.
What are the key properties of 2-chloro-4-methoxy-5,6-dimethylpyrimidine;ethane?
2-chloro-4-methoxy-5,6-dimethylpyrimidine;ethane has a molecular weight of 202.68 g/mol, XLogP of 2.78, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-methoxy-5,6-dimethylpyrimidine;ethane is sourced from PubChem (CID 155571429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).