C25H20ClN5O4 — CID 155571539
methyl 2-amino-3-[5-chloro-2-[2-(5-cyano-2-methyl-4-oxopyrido[3,4-d]pyrimidin-3-yl)ethoxy]phenyl]benzoate (PubChem CID 155571539) has the molecular formula C25H20ClN5O4 and a molecular weight of 489.92 g/mol. Its IUPAC name is methyl 2-amino-3-[5-chloro-2-[2-(5-cyano-2-methyl-4-oxopyrido[3,4-d]pyrimidin-3-yl)ethoxy]phenyl]benzoate.
| Compound Name | methyl 2-amino-3-[5-chloro-2-[2-(5-cyano-2-methyl-4-oxopyrido[3,4-d]pyrimidin-3-yl)ethoxy]phenyl]benzoate |
|---|---|
| PubChem CID | 155571539 |
| Molecular Formula | C25H20ClN5O4 |
| Molecular Weight | 489.92 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | methyl 2-amino-3-[5-chloro-2-[2-(5-cyano-2-methyl-4-oxopyrido[3,4-d]pyrimidin-3-yl)ethoxy]phenyl]benzoate |
| SMILES | COC(=O)c1cccc(-c2cc(Cl)ccc2OCCn2c(C)nc3cncc(C#N)c3c2=O)c1N |
| InChI | InChI=1S/C25H20ClN5O4/c1-14-30-20-13-29-12-15(11-27)22(20)24(32)31(14)8-9-35-21-7-6-16(26)10-19(21)17-4-3-5-18(23(17)28)25(33)34-2/h3-7,10,12-13H,8-9,28H2,1-2H3 |
| InChIKey | DFEIHOMAULHHOD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 133.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.92 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|