C8H8F3NO3 — CID 155571875
(Z,2Z)-6,6,6-trifluoro-2-(hydroxymethylidene)-5-methyliminohex-3-enoic acid (PubChem CID 155571875) has the molecular formula C8H8F3NO3 and a molecular weight of 223.15 g/mol. Its IUPAC name is (Z,2Z)-6,6,6-trifluoro-2-(hydroxymethylidene)-5-methyliminohex-3-enoic acid.
| Compound Name | (Z,2Z)-6,6,6-trifluoro-2-(hydroxymethylidene)-5-methyliminohex-3-enoic acid |
|---|---|
| PubChem CID | 155571875 |
| Molecular Formula | C8H8F3NO3 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | (Z,2Z)-6,6,6-trifluoro-2-(hydroxymethylidene)-5-methyliminohex-3-enoic acid |
| SMILES | C/N=C(/C=C\C(=C\O)C(=O)O)C(F)(F)F |
| InChI | InChI=1S/C8H8F3NO3/c1-12-6(8(9,10)11)3-2-5(4-13)7(14)15/h2-4,13H,1H3,(H,14,15)/b3-2-,5-4-,12-6- |
| InChIKey | WQRUPKAARLBJHJ-SMEWWJLRSA-N |
| XLogP | 1.70 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|