About 3-methyl-2,5-diphenyl-3,4-dihydropyrazole
3-methyl-2,5-diphenyl-3,4-dihydropyrazole (PubChem CID 15557190) has the molecular formula C16H16N2
and a molecular weight of 236.32 g/mol. Its IUPAC name is 3-methyl-2,5-diphenyl-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 3-methyl-2,5-diphenyl-3,4-dihydropyrazole |
| PubChem CID | 15557190 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 3-methyl-2,5-diphenyl-3,4-dihydropyrazole |
| SMILES | CC1CC(c2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C16H16N2/c1-13-12-16(14-8-4-2-5-9-14)17-18(13)15-10-6-3-7-11-15/h2-11,13H,12H2,1H3 |
| InChIKey | JYAPQQUVUJCHDG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-2,5-diphenyl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2,5-diphenyl-3,4-dihydropyrazole?
The IUPAC name of 3-methyl-2,5-diphenyl-3,4-dihydropyrazole (CID 15557190) is 3-methyl-2,5-diphenyl-3,4-dihydropyrazole.
What is the SMILES notation for 3-methyl-2,5-diphenyl-3,4-dihydropyrazole?
The canonical SMILES for 3-methyl-2,5-diphenyl-3,4-dihydropyrazole is CC1CC(c2ccccc2)=NN1c1ccccc1.
What is the InChIKey of 3-methyl-2,5-diphenyl-3,4-dihydropyrazole?
The InChIKey is JYAPQQUVUJCHDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2/c1-13-12-16(14-8-4-2-5-9-14)17-18(13)15-10-6-3-7-11-15/h2-11,13H,12H2,1H3.
What are the key properties of 3-methyl-2,5-diphenyl-3,4-dihydropyrazole?
3-methyl-2,5-diphenyl-3,4-dihydropyrazole has a molecular weight of 236.32 g/mol, XLogP of 3.69, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2,5-diphenyl-3,4-dihydropyrazole is sourced from PubChem (CID 15557190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).