C15H24F3NOS — CID 155572002
3-ethyl-5-methyl-2-propan-2-ylthiophene;N-(1,1,1-trifluoro-2-methylpropan-2-yl)formamide (PubChem CID 155572002) has the molecular formula C15H24F3NOS and a molecular weight of 323.42 g/mol. Its IUPAC name is 3-ethyl-5-methyl-2-propan-2-ylthiophene;N-(1,1,1-trifluoro-2-methylpropan-2-yl)formamide.
| Compound Name | 3-ethyl-5-methyl-2-propan-2-ylthiophene;N-(1,1,1-trifluoro-2-methylpropan-2-yl)formamide |
|---|---|
| PubChem CID | 155572002 |
| Molecular Formula | C15H24F3NOS |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | 3-ethyl-5-methyl-2-propan-2-ylthiophene;N-(1,1,1-trifluoro-2-methylpropan-2-yl)formamide |
| SMILES | CC(C)(NC=O)C(F)(F)F.CCc1cc(C)sc1C(C)C |
| InChI | InChI=1S/C10H16S.C5H8F3NO/c1-5-9-6-8(4)11-10(9)7(2)3;1-4(2,9-3-10)5(6,7)8/h6-7H,5H2,1-4H3;3H,1-2H3,(H,9,10) |
| InChIKey | ZYLGGAKJINXHSP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|