C29H21F2N3O3S2 — CID 155572047
2-(1,3-benzoxazol-2-yl)-4-[2-(2,4-difluorophenoxy)-5-(ethylsulfanylamino)phenyl]-6-methylthieno[2,3-c]pyridin-7-one (PubChem CID 155572047) has the molecular formula C29H21F2N3O3S2 and a molecular weight of 561.64 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-4-[2-(2,4-difluorophenoxy)-5-(ethylsulfanylamino)phenyl]-6-methylthieno[2,3-c]pyridin-7-one.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-4-[2-(2,4-difluorophenoxy)-5-(ethylsulfanylamino)phenyl]-6-methylthieno[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 155572047 |
| Molecular Formula | C29H21F2N3O3S2 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.10 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-4-[2-(2,4-difluorophenoxy)-5-(ethylsulfanylamino)phenyl]-6-methylthieno[2,3-c]pyridin-7-one |
| SMILES | CCSNc1ccc(Oc2ccc(F)cc2F)c(-c2cn(C)c(=O)c3sc(-c4nc5ccccc5o4)cc23)c1 |
| InChI | InChI=1S/C29H21F2N3O3S2/c1-3-38-33-17-9-11-23(36-24-10-8-16(30)12-21(24)31)18(13-17)20-15-34(2)29(35)27-19(20)14-26(39-27)28-32-22-6-4-5-7-25(22)37-28/h4-15,33H,3H2,1-2H3 |
| InChIKey | XFKRLOASRQPEBF-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 69.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|