About ethane;6-ethoxy-N-ethylcyclohexa-1,5-dien-1-amine;molecular hydrogen
ethane;6-ethoxy-N-ethylcyclohexa-1,5-dien-1-amine;molecular hydrogen (PubChem CID 155572399) has the molecular formula C12H25NO
and a molecular weight of 199.34 g/mol. Its IUPAC name is ethane;6-ethoxy-N-ethylcyclohexa-1,5-dien-1-amine;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;6-ethoxy-N-ethylcyclohexa-1,5-dien-1-amine;molecular hydrogen |
| PubChem CID | 155572399 |
| Molecular Formula | C12H25NO |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.19 |
| IUPAC Name | ethane;6-ethoxy-N-ethylcyclohexa-1,5-dien-1-amine;molecular hydrogen |
| SMILES | CC.CCNC1=CCCC=C1OCC.[H][H] |
| InChI | InChI=1S/C10H17NO.C2H6.H2/c1-3-11-9-7-5-6-8-10(9)12-4-2;1-2;/h7-8,11H,3-6H2,1-2H3;1-2H3;1H |
| InChIKey | MKBULFOXJBUUNV-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;6-ethoxy-N-ethylcyclohexa-1,5-dien-1-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-ethoxy-N-ethylcyclohexa-1,5-dien-1-amine;molecular hydrogen?
The IUPAC name of ethane;6-ethoxy-N-ethylcyclohexa-1,5-dien-1-amine;molecular hydrogen (CID 155572399) is ethane;6-ethoxy-N-ethylcyclohexa-1,5-dien-1-amine;molecular hydrogen.
What is the SMILES notation for ethane;6-ethoxy-N-ethylcyclohexa-1,5-dien-1-amine;molecular hydrogen?
The canonical SMILES for ethane;6-ethoxy-N-ethylcyclohexa-1,5-dien-1-amine;molecular hydrogen is CC.CCNC1=CCCC=C1OCC.[H][H].
What is the InChIKey of ethane;6-ethoxy-N-ethylcyclohexa-1,5-dien-1-amine;molecular hydrogen?
The InChIKey is MKBULFOXJBUUNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO.C2H6.H2/c1-3-11-9-7-5-6-8-10(9)12-4-2;1-2;/h7-8,11H,3-6H2,1-2H3;1-2H3;1H.
What are the key properties of ethane;6-ethoxy-N-ethylcyclohexa-1,5-dien-1-amine;molecular hydrogen?
ethane;6-ethoxy-N-ethylcyclohexa-1,5-dien-1-amine;molecular hydrogen has a molecular weight of 199.34 g/mol, XLogP of 3.47, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-ethoxy-N-ethylcyclohexa-1,5-dien-1-amine;molecular hydrogen is sourced from PubChem (CID 155572399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).