About ethane;2-methyl-6-(1-methylpiperidin-4-yl)-1,3-benzothiazole
ethane;2-methyl-6-(1-methylpiperidin-4-yl)-1,3-benzothiazole (PubChem CID 155572427) has the molecular formula C16H24N2S
and a molecular weight of 276.45 g/mol. Its IUPAC name is ethane;2-methyl-6-(1-methylpiperidin-4-yl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | ethane;2-methyl-6-(1-methylpiperidin-4-yl)-1,3-benzothiazole |
| PubChem CID | 155572427 |
| Molecular Formula | C16H24N2S |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | ethane;2-methyl-6-(1-methylpiperidin-4-yl)-1,3-benzothiazole |
| SMILES | CC.Cc1nc2ccc(C3CCN(C)CC3)cc2s1 |
| InChI | InChI=1S/C14H18N2S.C2H6/c1-10-15-13-4-3-12(9-14(13)17-10)11-5-7-16(2)8-6-11;1-2/h3-4,9,11H,5-8H2,1-2H3;1-2H3 |
| InChIKey | LJKSJJRMXWMPSB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-methyl-6-(1-methylpiperidin-4-yl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyl-6-(1-methylpiperidin-4-yl)-1,3-benzothiazole?
The IUPAC name of ethane;2-methyl-6-(1-methylpiperidin-4-yl)-1,3-benzothiazole (CID 155572427) is ethane;2-methyl-6-(1-methylpiperidin-4-yl)-1,3-benzothiazole.
What is the SMILES notation for ethane;2-methyl-6-(1-methylpiperidin-4-yl)-1,3-benzothiazole?
The canonical SMILES for ethane;2-methyl-6-(1-methylpiperidin-4-yl)-1,3-benzothiazole is CC.Cc1nc2ccc(C3CCN(C)CC3)cc2s1.
What is the InChIKey of ethane;2-methyl-6-(1-methylpiperidin-4-yl)-1,3-benzothiazole?
The InChIKey is LJKSJJRMXWMPSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2S.C2H6/c1-10-15-13-4-3-12(9-14(13)17-10)11-5-7-16(2)8-6-11;1-2/h3-4,9,11H,5-8H2,1-2H3;1-2H3.
What are the key properties of ethane;2-methyl-6-(1-methylpiperidin-4-yl)-1,3-benzothiazole?
ethane;2-methyl-6-(1-methylpiperidin-4-yl)-1,3-benzothiazole has a molecular weight of 276.45 g/mol, XLogP of 4.44, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyl-6-(1-methylpiperidin-4-yl)-1,3-benzothiazole is sourced from PubChem (CID 155572427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).