C17H23BN4O2 — CID 155572908
2-N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-methyl-4-N-pentan-3-ylpyrimidine-2,4-diamine (PubChem CID 155572908) has the molecular formula C17H23BN4O2 and a molecular weight of 326.21 g/mol. Its IUPAC name is 2-N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-methyl-4-N-pentan-3-ylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-methyl-4-N-pentan-3-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 155572908 |
| Molecular Formula | C17H23BN4O2 |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 2-N-(1-hydroxy-3H-2,1-benzoxaborol-5-yl)-5-methyl-4-N-pentan-3-ylpyrimidine-2,4-diamine |
| SMILES | CCC(CC)Nc1nc(Nc2ccc3c(c2)COB3O)ncc1C |
| InChI | InChI=1S/C17H23BN4O2/c1-4-13(5-2)20-16-11(3)9-19-17(22-16)21-14-6-7-15-12(8-14)10-24-18(15)23/h6-9,13,23H,4-5,10H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | HLYFSAUPIVRRCO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|