C24H32F2O — CID 155573184
1-(difluoromethoxy)-2-methyl-4-[2-methyl-4-(4-methylcyclohexyl)phenyl]benzene;ethane (PubChem CID 155573184) has the molecular formula C24H32F2O and a molecular weight of 374.52 g/mol. Its IUPAC name is 1-(difluoromethoxy)-2-methyl-4-[2-methyl-4-(4-methylcyclohexyl)phenyl]benzene;ethane.
| Compound Name | 1-(difluoromethoxy)-2-methyl-4-[2-methyl-4-(4-methylcyclohexyl)phenyl]benzene;ethane |
|---|---|
| PubChem CID | 155573184 |
| Molecular Formula | C24H32F2O |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.24 |
| IUPAC Name | 1-(difluoromethoxy)-2-methyl-4-[2-methyl-4-(4-methylcyclohexyl)phenyl]benzene;ethane |
| SMILES | CC.Cc1cc(-c2ccc(C3CCC(C)CC3)cc2C)ccc1OC(F)F |
| InChI | InChI=1S/C22H26F2O.C2H6/c1-14-4-6-17(7-5-14)18-8-10-20(15(2)12-18)19-9-11-21(16(3)13-19)25-22(23)24;1-2/h8-14,17,22H,4-7H2,1-3H3;1-2H3 |
| InChIKey | AJVWBUHZPNJNEH-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |