About (R)-(6-chloroimidazo[1,5-a]pyridin-5-yl)-(1-phenyltriazol-4-yl)methanol
(R)-(6-chloroimidazo[1,5-a]pyridin-5-yl)-(1-phenyltriazol-4-yl)methanol (PubChem CID 155573603) has the molecular formula C16H12ClN5O
and a molecular weight of 325.76 g/mol. Its IUPAC name is (R)-(6-chloroimidazo[1,5-a]pyridin-5-yl)-(1-phenyltriazol-4-yl)methanol.
Molecular Properties
| Compound Name | (R)-(6-chloroimidazo[1,5-a]pyridin-5-yl)-(1-phenyltriazol-4-yl)methanol |
| PubChem CID | 155573603 |
| Molecular Formula | C16H12ClN5O |
| Molecular Weight | 325.76 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | (R)-(6-chloroimidazo[1,5-a]pyridin-5-yl)-(1-phenyltriazol-4-yl)methanol |
| SMILES | O[C@@H](c1cn(-c2ccccc2)nn1)c1c(Cl)ccc2cncn12 |
| InChI | InChI=1S/C16H12ClN5O/c17-13-7-6-12-8-18-10-21(12)15(13)16(23)14-9-22(20-19-14)11-4-2-1-3-5-11/h1-10,16,23H/t16-/m0/s1 |
| InChIKey | CCHJFTLUGZUJFW-INIZCTEOSA-N |
| XLogP | 2.65 |
| TPSA | 68.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.76 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (R)-(6-chloroimidazo[1,5-a]pyridin-5-yl)-(1-phenyltriazol-4-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-(6-chloroimidazo[1,5-a]pyridin-5-yl)-(1-phenyltriazol-4-yl)methanol?
The IUPAC name of (R)-(6-chloroimidazo[1,5-a]pyridin-5-yl)-(1-phenyltriazol-4-yl)methanol (CID 155573603) is (R)-(6-chloroimidazo[1,5-a]pyridin-5-yl)-(1-phenyltriazol-4-yl)methanol.
What is the SMILES notation for (R)-(6-chloroimidazo[1,5-a]pyridin-5-yl)-(1-phenyltriazol-4-yl)methanol?
The canonical SMILES for (R)-(6-chloroimidazo[1,5-a]pyridin-5-yl)-(1-phenyltriazol-4-yl)methanol is O[C@@H](c1cn(-c2ccccc2)nn1)c1c(Cl)ccc2cncn12.
What is the InChIKey of (R)-(6-chloroimidazo[1,5-a]pyridin-5-yl)-(1-phenyltriazol-4-yl)methanol?
The InChIKey is CCHJFTLUGZUJFW-INIZCTEOSA-N. The full InChI is InChI=1S/C16H12ClN5O/c17-13-7-6-12-8-18-10-21(12)15(13)16(23)14-9-22(20-19-14)11-4-2-1-3-5-11/h1-10,16,23H/t16-/m0/s1.
What are the key properties of (R)-(6-chloroimidazo[1,5-a]pyridin-5-yl)-(1-phenyltriazol-4-yl)methanol?
(R)-(6-chloroimidazo[1,5-a]pyridin-5-yl)-(1-phenyltriazol-4-yl)methanol has a molecular weight of 325.76 g/mol, XLogP of 2.65, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-(6-chloroimidazo[1,5-a]pyridin-5-yl)-(1-phenyltriazol-4-yl)methanol is sourced from PubChem (CID 155573603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).