About [(1R)-5-fluoro-2-bicyclo[4.1.0]hepta-2,4,6-trienyl]methanamine
[(1R)-5-fluoro-2-bicyclo[4.1.0]hepta-2,4,6-trienyl]methanamine (PubChem CID 155573791) has the molecular formula C8H8FN
and a molecular weight of 137.16 g/mol. Its IUPAC name is [(1R)-5-fluoro-2-bicyclo[4.1.0]hepta-2,4,6-trienyl]methanamine.
Molecular Properties
| Compound Name | [(1R)-5-fluoro-2-bicyclo[4.1.0]hepta-2,4,6-trienyl]methanamine |
| PubChem CID | 155573791 |
| Molecular Formula | C8H8FN |
| Molecular Weight | 137.16 g/mol |
| Exact Mass | 137.06 |
| IUPAC Name | [(1R)-5-fluoro-2-bicyclo[4.1.0]hepta-2,4,6-trienyl]methanamine |
| SMILES | NCC1=CC=C(F)C2=C[C@H]12 |
| InChI | InChI=1S/C8H8FN/c9-8-2-1-5(4-10)6-3-7(6)8/h1-3,6H,4,10H2/t6-/m1/s1 |
| InChIKey | UDKKEFOBLIOWNM-ZCFIWIBFSA-N |
| XLogP | 1.29 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(1R)-5-fluoro-2-bicyclo[4.1.0]hepta-2,4,6-trienyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-5-fluoro-2-bicyclo[4.1.0]hepta-2,4,6-trienyl]methanamine?
The IUPAC name of [(1R)-5-fluoro-2-bicyclo[4.1.0]hepta-2,4,6-trienyl]methanamine (CID 155573791) is [(1R)-5-fluoro-2-bicyclo[4.1.0]hepta-2,4,6-trienyl]methanamine.
What is the SMILES notation for [(1R)-5-fluoro-2-bicyclo[4.1.0]hepta-2,4,6-trienyl]methanamine?
The canonical SMILES for [(1R)-5-fluoro-2-bicyclo[4.1.0]hepta-2,4,6-trienyl]methanamine is NCC1=CC=C(F)C2=C[C@H]12.
What is the InChIKey of [(1R)-5-fluoro-2-bicyclo[4.1.0]hepta-2,4,6-trienyl]methanamine?
The InChIKey is UDKKEFOBLIOWNM-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H8FN/c9-8-2-1-5(4-10)6-3-7(6)8/h1-3,6H,4,10H2/t6-/m1/s1.
What are the key properties of [(1R)-5-fluoro-2-bicyclo[4.1.0]hepta-2,4,6-trienyl]methanamine?
[(1R)-5-fluoro-2-bicyclo[4.1.0]hepta-2,4,6-trienyl]methanamine has a molecular weight of 137.16 g/mol, XLogP of 1.29, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-5-fluoro-2-bicyclo[4.1.0]hepta-2,4,6-trienyl]methanamine is sourced from PubChem (CID 155573791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).