About 3a,6a-dimethyl-3,4-dihydrofuro[2,3-b]furan-2,5-dione
3a,6a-dimethyl-3,4-dihydrofuro[2,3-b]furan-2,5-dione (PubChem CID 15557423) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is 3a,6a-dimethyl-3,4-dihydrofuro[2,3-b]furan-2,5-dione.
Analyze 3a,6a-dimethyl-3,4-dihydrofuro[2,3-b]furan-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3a,6a-dimethyl-3,4-dihydrofuro[2,3-b]furan-2,5-dione?
The IUPAC name of 3a,6a-dimethyl-3,4-dihydrofuro[2,3-b]furan-2,5-dione (CID 15557423) is 3a,6a-dimethyl-3,4-dihydrofuro[2,3-b]furan-2,5-dione.
What is the SMILES notation for 3a,6a-dimethyl-3,4-dihydrofuro[2,3-b]furan-2,5-dione?
The canonical SMILES for 3a,6a-dimethyl-3,4-dihydrofuro[2,3-b]furan-2,5-dione is CC12CC(=O)OC1(C)OC(=O)C2.
What is the InChIKey of 3a,6a-dimethyl-3,4-dihydrofuro[2,3-b]furan-2,5-dione?
The InChIKey is VZJIPCLDHZYSNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4/c1-7-3-5(9)11-8(7,2)12-6(10)4-7/h3-4H2,1-2H3.
What are the key properties of 3a,6a-dimethyl-3,4-dihydrofuro[2,3-b]furan-2,5-dione?
3a,6a-dimethyl-3,4-dihydrofuro[2,3-b]furan-2,5-dione has a molecular weight of 170.16 g/mol, XLogP of 0.60, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3a,6a-dimethyl-3,4-dihydrofuro[2,3-b]furan-2,5-dione is sourced from PubChem (CID 15557423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).